2',3'-Dideoxy-2',3'-didehydro-2'-fluorocytidine
2',3'-Dideoxy-2',3'-didehydro-2'-fluorocytidine, a remarkable and potent antiviral marvel, emerges as a beacon of promise in the battle against the formidable adversaries HIV and hepatitis B. Acting with surgical precision, this miraculous agent exclusively targets and obstructs the reverse transcriptase enzyme, abruptly arresting viral replication and decisively quelling the burdensome viral load.
| Supplier | BOC Sciences |
|---|---|
| Product # | 122757-53-3 |
| Pricing | Inquire |
| Cas | 122757-53-3 |
| Molecular Weight | 227.19 |
| Molecular Formula | C9H10FN3O3 |
| Canonical SMILES | C1=CN(C(=O)N=C1N)C2C(=CC(O2)CO)F |