5'-O-TBDMS-N2-isobutyryl-2'-deoxyguanosine
5'-O-TBDMS-N2-isobutyryl-2'-deoxyguanosine, a nucleoside analog, is an intricate and multifaceted tool, crucial in the synthesis of antisense oligonucleotides, employed for the treatment of a variety of devastating ailments like viral infections and cancer. Alongside this, it is a significant addition to the biomedical arsenal as it helps researchers study gene expression. Its myriad of uses and intricate nature is indispensable in contemporary scientific research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 85326-10-9 |
| Pricing | Inquire |
| Cas | 85326-10-9 |
| Molecular Weight | 451.60 |
| Molecular Formula | C20H33N5O5Si |
| Canonical SMILES | CC(C)C(=O)NC1=NC2=C(C(=O)N1)N=CN2C3CC(C(O3)CO[Si](C)(C)C(C)(C)C)O |