5'-Guanylylmethylenediphosphonate
5'-Guanylylmethylenediphosphonate is a crucial compound used in the research of various diseases serving as a potent inhibitor of adenylate cyclase, which can help regulate intracellular cyclic AMP levels. Additionally, 5'-Guanylylmethylenediphosphonate is used in research studies to investigate the mechanism of enzyme inhibition and to develop potential therapeutic strategies targeting adenylate cyclase.
| Supplier | BOC Sciences |
|---|---|
| Product # | 13912-93-1 |
| Pricing | Inquire |
| Cas | 13912-93-1 |
| Molecular Weight | 521.21 |
| Molecular Formula | C11H18N5O13P3 |
| Canonical SMILES | C1=NC2=C(N1C3C(C(C(O3)COP(=O)(O)OP(=O)(CP(=O)(O)O)O)O)O)N=C(NC2=O)N |