7-Deaza-2',3'-dideoxyadenosine
7-Deaza-2',3'-dideoxyadenosine, a potent pharmaceutical medication, is an agent utilized in the pharmacological combat against viral infections. Its inhibition of reverse transcriptase metabolism profoundly suppresses replication of viral genomes within the infected host, thereby attenuating the severity and progression of viral infections such as herpes, HIV, and hepatitis B and C. This medication is highly efficacious and, when employed in combination with other antiviral drugs, has demonstrated to be an optimistic therapeutic avenue to abate the development of resistance against viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 40627-30-3 |
| Pricing | Inquire |
| Cas | 40627-30-3 |
| Molecular Weight | 234.25 |
| Molecular Formula | C11H14N4O2 |
| Canonical SMILES | C1CC(OC1CO)N2C=CC3=C(N=CN=C32)N |