17-Trifluoromethylphenyl trinor prostaglandin F2α
17-Trifluoromethylphenyl trinor PGF2α bears an aromatic ring which is reminiscent of the trifluoromethyl-phenoxy ring of travoprost ((+)-fluprostenol isopropyl ester). As an ocular hypotensive agent, it would be expected that 17-trifluoromethylphenyl trinor PGF2α would act very much like the free acid of travoprost.
| Supplier | BOC Sciences |
|---|---|
| Product # | 221246-34-0 |
| Pricing | Inquire |
| Cas | 221246-34-0 |
| Molecular Weight | 456.5 |
| Molecular Formula | C24H31O5F3 |
| Canonical SMILES | CCC1[CH]CC(C1C=CC(CCC2=CC(=CC=C2)C(F)(F)F)O)O |