N4-Benzoyl-5'-O-(4,4'-dimethoxytrityl)-aracytidine
N4-Benzoyl-5'-O-(4,4'-dimethoxytrityl)-aracytidine, a highly esteemed and significant compound extensively employed in the biomedical sector, exhibits immense potential. This geological marvel assumes a paramount position in combating viral afflictions, encompassing select strains of herpes and malignancies attributed to viral etiology.
| Supplier | BOC Sciences |
|---|---|
| Product # | 87418-76-6 |
| Pricing | Inquire |
| Cas | 87418-76-6 |
| Molecular Weight | 649.69 |
| Molecular Formula | C37H35N3O8 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC4C(C(C(O4)N5C=CC(=NC5=O)NC(=O)C6=CC=CC=C6)O)O |