6-(Diethylamino)spiro[isobenzofuran-1(3H),9-[9H]xanthen]-3-yl b-D-galactopyranoside
6-(Diethylamino)spiro[isobenzofuran-1(3H),9-[9H]xanthen]-3-yl b-D-galactopyranoside, also known as DEASIBFXG, is an essential biomedical tool in the realm of pharmaceutical innovation. Primarily engineered for unravelling the elusive cellular targets, it propels the research of oncology, infectious ailments and enigmatic neurological disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1326231-95-1 |
| Pricing | Inquire |
| Cas | 1326231-95-1 |
| Molecular Weight | 535.58 |
| Molecular Formula | C30H33NO8 |
| Canonical SMILES | CCN(CC)C1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)OC5C(C(C(C(O5)CO)O)O)O)C6=CC=CC=C6CO3 |