3,4-Di-O-acetyl-1,6-anhydro-2-O-p-toluenesulfonyl-b-D-glucopyranose
3,4-Di-O-acetyl-1,6-anhydro-2-O-p-toluenesulfonyl-b-D-glucopyranose is a valuable compound used in the biomedicine industry. It exhibits potential as an antiviral agent, particularly against Herpes Simplex Virus-1. With its unique acetyl and tosyl groups, this compound shows promising results in inhibiting viral replication and could provide insights for the development of novel antiviral drugs.
| Supplier | BOC Sciences |
|---|---|
| Product # | 84207-46-5 |
| Pricing | Inquire |
| Cas | 84207-46-5 |
| Molecular Weight | 400.40 |
| Molecular Formula | C17H20O9S |
| Canonical SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2C(C(C3COC2O3)OC(=O)C)OC(=O)C |