3-N-(BOC)aminomethylphenylboronic acid
3-N-(BOC)aminomethylphenylboronic acid can effectively produce adhesion to different target molecules, thereby coordinating cellular mechanisms and curbing the development of diseases, and has been used in cancer and diabetes drug development.
| Supplier | BOC Sciences |
|---|---|
| Product # | 199609-62-6 |
| Pricing | Inquire |
| Cas | 199609-62-6 |
| Molecular Weight | 251.1 |
| Molecular Formula | C12H18BNO4 |
| Canonical SMILES | B(C1=CC(=CC=C1)CNC(=O)OC(C)(C)C)(O)O |