1,2,3,4-Tetra-O-acetyl-b-D-ribopyranose
1,2,3,4-Tetra-O-acetyl-b-D-ribopyranose is a crucial compound used in the biomedical industry for various applications. It is commonly utilized in the synthesis of pharmaceutical drugs used to treat a wide range of diseases. This compound plays a significant role in drug development and formulation, serving as a building block in the creation of effective medications targeting specific ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4049-34-7 |
| Pricing | Inquire |
| Cas | 4049-34-7 |
| Molecular Weight | 318.28 |
| Molecular Formula | C13H18O9 |
| Canonical SMILES | CC(=O)OC1COC(C(C1OC(=O)C)OC(=O)C)OC(=O)C |