Dihydrofolic acid
Dihydrofolic acid, also known as dihydrofolate, is a form of folic acid (vitamin B9) that plays a critical role in cellular metabolism and the synthesis of nucleic acids. It is an intermediate in the metabolism of folate and is further reduced to tetrahydrofolic acid (THF), which is the active form used in the body for various biochemical reactions. Dihydrofolic acid plays a crucial role in the synthesis of purines and thymidylate, which are necessary for DNA and RNA synthesis. It is involved in the transfer of one-carbon units in the metabolism of amino acids and nucleotides.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4033-27-6 |
| Pricing | Inquire |
| Cas | 4033-27-6 |
| Molecular Weight | 443.41 |
| Molecular Formula | C19H21N7O6 |
| Canonical SMILES | C1C(=NC2=C(N1)N=C(NC2=O)N)CNC3=CC=C(C=C3)C(=O)NC(CCC(=O)O)C(=O)O |