Rhodirubin B
It is produced by the strain of Str. sp. ME505-HE1. Rhodirubin B has a strong anti-gram-positive bacteria effect, and also has an effect on Mycobacterium. It can also prolong the survival time of mice inoculated with leukemia L-1210.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02189 |
| Pricing | Inquire |
| Cas | 64502-82-5 |
| Molecular Weight | 813.88 |
| Molecular Formula | C42H55NO15 |
| Canonical SMILES | CCC1(CC(C2=C(C3=C(C=C2C1C(=O)OC)C(=O)C4=C(C=CC(=C4C3=O)O)O)O)OC5CC(C(C(O5)C)OC6CCC(C(O6)C)OC7CCC(C(O7)C)O)N(C)C)O |