4-Methylumbelliferyl b-D-xylopyranoside
4-Methylumbelliferyl b-D-xylopyranoside, an indispensable entity in the realm of biomedical science, serves as an invaluable resource. Functioning primarily as a substrate for esteemed b-xylosidase enzymes, it additionally assumes the role of a luminescent indicator in the investigation of carbohydrate metabolism. Through its implementation, the comprehensive assessment and identification of diverse medicinal compounds and afflictions linked to b-xylosidase activity can be efficiently accomplished, thereby significantly contributing to the advancement of cutting-edge research and diagnostic endeavors.
| Supplier | BOC Sciences |
|---|---|
| Product # | 6734-33-4 |
| Pricing | Inquire |
| Cas | 6734-33-4 |
| Molecular Weight | 308.28 |
| Molecular Formula | C15H16O7 |
| Canonical SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)OC3C(C(C(CO3)O)O)O |