Purvalanol B
Purvalanol B is a potent, selective, reversible and ATP-competitive inhibitor of CDK with IC50 values of 6, 6, 9, > 10,000, and 6 nM for cdc2/cyclin B, CDK2/cyclin A, CDK2/cyclin E, CDK4/cyclin D1 and CDK5-p35, respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1370-087426 |
| Pricing | Inquire |
| Cas | 212844-54-7 |
| Molecular Weight | 432.91 |
| Molecular Formula | C20H25ClN6O3 |
| Canonical SMILES | CC(C)C(CO)NC1=NC2=C(C(=N1)NC3=CC(=C(C=C3)C(=O)O)Cl)N=CN2C(C)C |