1-Chlorophthalazine HCl
1-Chlorophthalazine HCl is an exemplary pharmaceutical compound, indispensable in the research of migraines and diverse neurological disorders. Its remarkable potency as both a vasodilator and a serotonin receptor agonist culminates in profound research of distressing symptoms that entail migraines.
| Supplier | BOC Sciences |
|---|---|
| Product # | 300843-36-1 |
| Pricing | Inquire |
| Cas | 300843-36-1 |
| Molecular Weight | 201.06 |
| Molecular Formula | C8H5ClN2.HCl |
| Canonical SMILES | C1=CC=C2C(=C1)C=NN=C2Cl.Cl |