2',3'-Di-O-isopropylidene-2-thiouridine
2',3'-Di-O-isopropylidene-2-thiouridine, a modified nucleoside, is widely utilized during RNA synthesis due to its capacity to boost stability and specificity. Its versatility extends to therapeutic arenas such as antisense therapy and RNA interference, with potential use against viral infections and cancer demonstrated during studies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 6984-55-0 |
| Pricing | Inquire |
| Cas | 6984-55-0 |
| Molecular Weight | 300.33 |
| Molecular Formula | C12H16N2O5S |
| Canonical SMILES | CC1(OC2C(OC(C2O1)N3C=CC(=O)NC3=S)CO)C |