2'-Deoxy-5'-O-DMT-N2-isobutyrylguanosine
2'-Deoxy-5'-O-DMT-N2-isobutyrylguanosine, an invaluable component employed in cutting-edge biomedical investigations, showcases promise in combatting diverse malignancies and viral afflictions. With its unparalleled configuration and attributes, it emerges as a potent instrument for scrutinizing mechanisms of DNA replication and mending. By harnessing this compound, one can delve into drug synthesis advancements and explore gene therapy, thereby illuminating potential remedies against prevalent conditions encompassing leukemia, lung cancer, and HIV.
| Supplier | BOC Sciences |
|---|---|
| Product # | 68892-41-1 |
| Pricing | Inquire |
| Cas | 68892-41-1 |
| Molecular Weight | 639.70 |
| Molecular Formula | C35H37N5O7 |
| Canonical SMILES | CC(C)C(=O)NC1=NC2=C(C(=O)N1)N=CN2C3CC(C(O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)O |