9-(3-Deoxy-3-fluoro-beta-D-ribofuranosyl)purine
9-(3-Deoxy-3-fluoro-beta-D-ribofuranosyl)purine is an exceptionally potent biomedical agent extensively employed to combat viral infections. With remarkable precision, it aims at impeding viral replication and dissemination. This compound exhibits immense promise in the therapeutic management of a diverse array of viral afflictions, encompassing respiratory infections, herpes, and multiple forms of viral hepatitis. Mechanistically, it exerts its effects by obstructing crucial viral enzymes indispensable for the synthesis of viral DNA/RNA, thereby impeding their capacity to proliferate and induce further harm to the host organism.
| Supplier | BOC Sciences |
|---|---|
| Product # | 124775-29-7 |
| Pricing | Inquire |
| Cas | 124775-29-7 |
| Molecular Weight | 254.22 |
| Molecular Formula | C10H11FN4O3 |
| Canonical SMILES | C1=C2C(=NC=N1)N(C=N2)C3C(C(C(O3)CO)F)O |