3'-O-TBDMS-2'-O-Me-rA(Bz)
3'-O-TBDMS-2'-O-Me-rA(Bz) is a modified ribonucleoside where a tert-butyldimethylsilyl (TBDMS) group is attached to the 3'-hydroxyl position, and a methyl group is attached to the 2'-hydroxyl position of adenosine. Additionally, the adenine base is protected by a benzoyl (Bz) group. This modification enhances the stability and reactivity of the ribonucleoside, making it useful for the synthesis of RNA oligonucleotides, particularly in solid-phase synthesis methodologies.
| Supplier | BOC Sciences |
|---|---|
| Product # | BRP-00722 |
| Pricing | Inquire |
| Cas | 454424-09-0 |
| Molecular Weight | 499.64 |
| Molecular Formula | C24H33N5O5Si |
| Canonical SMILES | CC(C)(C)[Si](C)(C)OC1C(OC(C1OC)N2C=NC3=C(N=CN=C32)NC(=O)C4=CC=CC=C4)CO |