Rubeomycin A
It is originally isolated from Actinomadura soseoviolacea var. biwakoensis. Rubeomycin A has the effect of anti-gram-positive bacteria, but not anti-gram-negative bacteria and fungi. It has also been shown to inhibit Yoshida sarcoma cells and leukemia P388 cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02211 |
| Pricing | Inquire |
| Molecular Weight | 659.68 |
| Molecular Formula | C33H41NO13 |
| Canonical SMILES | CC1C(C(CC(O1)OC2CC(CC3=C2C(=C4C(=C3O)C(=O)C5=C(C4=O)C(=CC=C5)O)O)(C(=O)C)O)N)OC(CC(C)O)OC(C)CO |