Ibuprofen EP Impurity K
Ibuprofen EP Impurity K is a degradation product of Ibuprofen arising from oxidative and thermal treatment. Ibuprofen is a nonsteroidal anti-inflammatory drug (NSAID) used to treat mild to moderate pain.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2694-212829 |
| Pricing | Inquire |
| Cas | 43153-07-7 |
| Molecular Weight | 178.19 |
| Molecular Formula | C10H10O3 |
| Canonical SMILES | CC(C1=CC=C(C=C1)C=O)C(=O)O |