Des-[N-(4-chloro-2-methyl-6[((methylamino)carboyl))phenyl]] Chlorantraniliprole
Des-[N-(4-chloro-2-methyl-6[((methylamino)carboyl))phenyl]] Chlorantraniliprole is an impurity of Chlorantraniliprole (C325380). Chlorantraniliprole is a pyrazolylpyridine insecticide and an activator of insect ryanodine receptor. Used in Pesticide detection. Des-[N-(4-chloro-2-methyl-6[((methylamino)carboyl))phenyl]] Chlorantraniliprole can also be used for anti-cancer and insecticidal properties.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB062681 |
| Pricing | Inquire |
| Cas | 1438853-57-6 |
| Molecular Weight | 301.53 |
| Molecular Formula | C9H6BrClN4O |
| Canonical SMILES | C1=CC(=C(N=C1)N2C(=CC(=N2)Br)C(=O)N)Cl |