N-[2-(di-1-adamantylphosphino)phenyl]morpholine, 98% Mor-DalPhos
MorDalphos is an electronically rich, sterically hindered P,N-based ancillary ligand developed by the Stradiotto group that can be used in the Buchwald-Hartwig Amination reaction, alkyne hydroamination and monoarylation of compounds such as ammonia, hydrazine, and acetone.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1237588-12-3 |
| Pricing | Inquire |
| Cas | 1237588-12-3 |
| Molecular Weight | 463.63 |
| Molecular Formula | C30H42NOP |
| Canonical SMILES | C1COCCN1C2=CC=CC=C2P(C34CC5CC(C3)CC(C5)C4)C67CC8CC(C6)CC(C8)C7 |