Rifaximin EP Impurity B
Rifaximin EP Impurity B is an impurity of Rifaximin. Rifaximin is a semi-synthetic, nonsystemic antibiotic derived from rifamycin SV with antibacterial activity. It also acts as a pregnane X receptor (PXR) agonist. It is approved for the treatment of traveler's diarrhea, irritable bowel syndrome, and hepatic encephalopathy.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02631 |
| Pricing | Inquire |
| Cas | 13929-35-6 |
| Molecular Weight | 755.80 |
| Molecular Formula | C39H49NO14 |
| Canonical SMILES | CC1C=CC=C(C(=O)NC2=CC(=C3C(=C2O)C(=C(C4=C3C(=O)C(O4)(OC=CC(C(C(C(C(C(C1O)C)O)C)OC(=O)C)C)OC)C)C)O)OCC(=O)O)C |