Verapamil Impurity J HCl
Verapamil Impurity J HCl is a metabolite of Verapamil. Verapamil is a medication used for the treatment of high blood pressure, chest pain from not enough blood flow to the heart, and supraventricular tachycardia.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1941-232336 |
| Pricing | Inquire |
| Cas | 67812-42-4 |
| Molecular Weight | 477.05 |
| Molecular Formula | C26H36N2O4. HCl |
| Canonical SMILES | CC(C)C(CCCNCCC1=CC(=C(C=C1)OC)OC)(C#N)C2=CC(=C(C=C2)OC)OC.Cl |