9-[(4-Carboxy-2,6-dimethylphenoxy)carbonyl]-10-(3-sulfopropyl)acridinium Inner Salt (>90%)
9-[(4-Carboxy-2,6-dimethylphenoxy)carbonyl]-10-(3-sulfopropyl)acridinium Inner Salt is an intermediate in synthesis of hydrophilic chemiluminescent acridinium esters containing N-sulfopropyl groups are extremely useful labels in the clinical diagnostics industry especialy in automated immunochemical analyzers such as Siemens Healthcare Diagnostics' ADVIA Centaur systems.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB070613 |
| Pricing | Inquire |
| Cas | 946423-58-1 |
| Molecular Weight | 493.53 |
| Molecular Formula | C26H23NO7S |
| Canonical SMILES | CC1=CC(=CC(=C1OC(=O)C2=C3C=CC=CC3=[N+](C4=CC=CC=C42)CCCS(=O)(=O)[O-])C)C(=O)O |