Fmoc-3,4-dehydro-L-proline
Fmoc-3,4-dehydro-L-proline, a chemical intermediary employed in the synthesis of peptides within the biomedical sector, displays considerable promise with regard to the treatment of conditions such as cancer and Alzheimer's disease. Its potential medical applications are extensive and merit further exploration.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-007331 |
| Pricing | Inquire |
| Cas | 135837-63-7 |
| Molecular Weight | 335.36 |
| Molecular Formula | C20H17NO4 |
| Canonical SMILES | C1C=CC(N1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |