(1-hydroxyethylidene)bisphosphonic acid, sodium salt
HEDP·Na is the mono-sodium salt of HEDP, and is mostly suitable for acidic scale inhibitors and detergents, can be used for metal surface cleaning, metal treatment and metal ion control, etc.
| Supplier | BOC Sciences |
|---|---|
| Product # | 29329-71-3 |
| Pricing | Inquire |
| Cas | 29329-71-3 |
| Molecular Weight | 249.99 |
| Molecular Formula | C2H4Na4O7P2 |
| Canonical SMILES | CC(O)(P(=O)(O)O)P(=O)(O)[O-].[Na+] |