2'-Chloro-N6-(3-methoxy)benzyladenosine
2'-Chloro-N6-(3-methoxy)benzyladenosine is a chemical compound used in biomedical research to study the role and function of adenosine receptors in the body. It has also been investigated for its potential therapeutic applications in treating cancer and inflammation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 722504-73-6 |
| Pricing | Inquire |
| Cas | 722504-73-6 |
| Molecular Weight | 421.83 |
| Molecular Formula | C18H20ClN5O5 |
| Canonical SMILES | COC1=CC=CC(=C1)CNC2=C3C(=NC(=N2)Cl)N(C=N3)C4C(C(C(O4)CO)O)O |