2'-Deoxy-5'-O-DMT-N6-isobutyryladenosine
2'-Deoxy-5'-O-DMT-N6-isobutyryladenosine, a highly potent chemical compound, holds immense significance in the field of biomedicine. As a pivotal drug intermediate, it aids in the treatment of a myriad of diseases. Moreover, its utilization in the synthesis of nucleoside analogs and nucleic acids drives advancements in antiviral, anticancer, and antifungal medications.
| Supplier | BOC Sciences |
|---|---|
| Product # | 190834-10-7 |
| Pricing | Inquire |
| Cas | 190834-10-7 |
| Molecular Weight | 623.72 |
| Molecular Formula | C35H37N5O6 |
| Canonical SMILES | CC(C)C(=O)Nc1c2c(ncn1)n(cn2)[C@H]3CC([C@H](O3)COC(c4ccccc4)(c5ccc(cc5)OC)c6ccc(cc6)OC)O |