6-Chloro-3-indolyl a-D-galactopyranoside
6-Chloro-3-indolyl α-D-galactopyranoside is a biochemical compound used in the compound industry. It acts as a substrate for the detection of β-galactosidase enzyme activity. This enzymatic reaction is widely utilized in diagnostics and research, providing valuable information about lac gene expression and cellular processes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 198402-61-8 |
| Pricing | Inquire |
| Cas | 198402-61-8 |
| Molecular Weight | 329.73 |
| Molecular Formula | C14H16ClNO6 |
| Canonical SMILES | C1=CC2=C(C=C1Cl)NC=C2OC3C(C(C(C(O3)CO)O)O)O |