N4-Benzoyl-3'-deoxy-5'-O-DMT-cytidine
N4-Benzoyl-3'-deoxy-5'-O-DMT-cytidine is a potent nucleoside analog used in biomedicine to target specific viral infections and cancer cells. By inhibiting DNA replication and cell division, it effectively treats viral infections caused by herpes simplex virus and varicella-zoster virus. Additionally, it demonstrates anti-cancer activity by suppressing tumor growth and inducing apoptosis in various cancer types. Its specificity and efficacy make it a valuable tool in the biomedical field for research and potential therapeutic applications.
| Supplier | BOC Sciences |
|---|---|
| Product # | 86234-45-9 |
| Pricing | Inquire |
| Cas | 86234-45-9 |
| Molecular Weight | 633.69 |
| Molecular Formula | C37H35N3O7 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC4CC(C(O4)N5C=CC(=NC5=O)NC(=O)C6=CC=CC=C6)O |