6-ROX-Phosphoramidite
6-ROX-Phosphoramidite is a fluorescent dye phosphoramidite used in the synthesis of labeled oligonucleotides. The 6-ROX (6-carboxy-X-rhodamine) dye is known for its strong fluorescence and is often used in molecular biology applications, such as real-time PCR, DNA sequencing, and fluorescence in situ hybridization (FISH). Incorporating 6-ROX into oligonucleotides allows for the visualization and tracking of nucleic acids in various research and diagnostic applications.
| Supplier | BOC Sciences |
|---|---|
| Product # | BRP-00400 |
| Pricing | Inquire |
| Molecular Weight | 834.01 |
| Molecular Formula | C48H60N5O6P |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCCCCCNC(=O)C1=CC(=C(C=C1)C(=O)[O-])C2=C3C=C4CCC[N+]5=C4C(=C3OC6=C2C=C7CCCN8C7=C6CCC8)CCC5)OCCC#N |