8-Oxo-GTP
8-Oxo-GTP, a nucleotide with modifications, is a valuable tool in discovering RNA oxidative and repair mechanisms. Its versatile use also includes investigations into Alzheimer's and Parkinson's, as well as cancer. Its potential to provide antioxidant properties demonstrates promise for defending against oxidative stress in various disease states.
| Supplier | BOC Sciences |
|---|---|
| Product # | 21238-36-8 |
| Pricing | Inquire |
| Cas | 21238-36-8 |
| Molecular Weight | 539.18 (free acid) |
| Molecular Formula | C10H16N5O15P3 (free acid) |
| Canonical SMILES | C(C1C(C(C(O1)N2C3=C(C(=O)NC(=N3)N)NC2=O)O)O)OP(=O)(O)OP(=O)(O)OP(=O)(O)O |