Bis(4-bromophenyl) ether
Bis(4-bromophenyl) ether (CAS# 2050-47-7) is a polybrominated di-Ph ether (PBDE), which is a flame retardant often incorporated into many polymers. PBDEs are an environmental pollutant that exhibit potential health risks to humans and wildlife.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2050-47-7 |
| Pricing | Inquire |
| Cas | 2050-47-7 |
| Molecular Weight | 328.00 |
| Molecular Formula | C12H8Br2O |
| Canonical SMILES | C1=CC(=CC=C1OC2=CC=C(C=C2)Br)Br |