4-Hydroxy-2-methylbenzenesulfonic Acid Hydrate
4-Hydroxy-2-methylbenzenesulfonic Acid is derived from m-Cresol (C781915), which is one of the components that make up liquid rice hull smoke, and may contribute to its anti-inflammatory effects in mice.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB060828 |
| Pricing | Inquire |
| Cas | 7134-05-6 |
| Molecular Weight | 188.20 + x(18.02) |
| Molecular Formula | C7H8O4S·xH2O |
| Canonical SMILES | CC1=C(C=CC(=C1)O)S(=O)(=O)O |