3-Methoxy-4-methylphenylacetic Acid
3-Methoxy-4-methylphenylacetic Acid is synthetically prepared by benzylic metalation of substituted toluenes using a mixed metal (Li/K) amide base to facilitate an anion migration from the kinetic to the benzylic metalation site.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB060332 |
| Pricing | Inquire |
| Cas | 100861-38-9 |
| Molecular Weight | 180.2 |
| Molecular Formula | C10H12O3 |
| Canonical SMILES | CC1=C(C=C(C=C1)CC(=O)O)OC |