Blood Group B trisaccharide
Blood Group B trisaccharide is an imperative constituent employed in biomedical investigations to explore the B blood group system, assuming the pivotal function of discerning blood type B antigens delicately emblazoned on erythrocytes. This discernment capability enables the detection and in-depth characterization of distinct blood types, thus facilitating comprehensive research of transfusion reactions, the genesis of antibodies and the indispensable compatibility appraisal for blood transfusions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 49777-14-2 |
| Pricing | Inquire |
| Cas | 49777-14-2 |
| Molecular Weight | 488.44 |
| Molecular Formula | C18H32O15 |
| Canonical SMILES | CC1C(C(C(C(O1)OC2C(C(C(OC2O)CO)O)OC3C(C(C(C(O3)CO)O)O)O)O)O)O |