N-Benzoyl-5'-O-DMT-2'-O-[(triisopropylsilyloxy)methyl]-adenosine 3'-CE phosphoramidite
N-Benzoyl-5'-O-DMT-2'-O-[(triisopropylsilyloxy)methyl]-adenosine 3'-CE phosphoramidite, a prominent element in the biomedical field, serves as a pharmaceutical asset for nucleic acid synthesis. Its paramount utility lies in facilitating drug innovation for adenosine receptor-focused therapies, pertinent to manifold conditions spanning from inflammatory ailments to cancerous manifestations and cardiovascular afflictions. Owing to its distinctive phosphoramidite framework, this agent augments nucleotide synthesis efficiency, thereby making considerable headway in the realm of medical exploration and experimentation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 220230-59-1 |
| Pricing | Inquire |
| Cas | 220230-59-1 |
| Molecular Weight | 1060.3 |
| Molecular Formula | C57H74N7O9PSi |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1C(OC(C1OCO[Si](C(C)C)(C(C)C)C(C)C)N2C=NC3=C(N=CN=C32)NC(=O)C4=CC=CC=C4)COC(C5=CC=CC=C5)(C6=CC=C(C=C6)OC)C7=CC=C(C=C7)OC |