2-O-(b-D-Mannopyranosyl)-D-mannopyranose
2-O-(b-D-Mannopyranosyl)-D-mannopyranose is a paramount compound, garnering immense attention for its indispensable role in elucidating the intricate interplay between carbohydrates and biological systems. This pivotal entity has emerged as a cornerstone for delving into the enigmatic realms of drug research and development, particularly in the context of research of pernicious afflictions such as diabetes, cancer, and multifarious microbial infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 50728-38-6 |
| Pricing | Inquire |
| Cas | 50728-38-6 |
| Molecular Weight | 342.30 |
| Molecular Formula | C12H22O11 |
| Canonical SMILES | C(C1C(C(C(C(O1)O)OC2C(C(C(C(O2)CO)O)O)O)O)O)O |