Fmoc-Dha-OH
Fmoc-Dha-OH, a pivotal intermediate, is used for synthesizing a plethora of biologically active compounds encompassing antimicrobial peptides, dipeptidyl peptidase IV inhibitors, and enzyme inhibitors. Researchers have employed it to fabricate Fmoc-Dha-OH-derived peptidomimetics manifested by the impeding activity against a myriad of cancer cell lines. The said compound holds sheer potential for the design and development of novel pharmaceutical agents targeting numerous diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-008269 |
| Pricing | Inquire |
| Cas | 261522-33-2 |
| Molecular Weight | 309.3 |
| Molecular Formula | C18H15NO4 |
| Canonical SMILES | C=C(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |