6-isobutyl-3-methyl-2,3-dihydro-1H-inden-1-one
6-isobutyl-3-methyl-2,3-dihydro-1H-inden-1-one is an impurity of ibuprofen, a racetam derivative with anticonvulsant (anti-epileptic) properties. Ibuprofen is a non-steroidal anti-inflammatory drug (NSAID) commonly used to relieve pain, reduce fever, and reduce inflammation. It can be used to treat menstrual pain, migraines, and rheumatoid arthritis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1340024-54-5 |
| Pricing | Inquire |
| Cas | 1340024-54-5 |
| Molecular Weight | 202.29 |
| Molecular Formula | C14H18O |
| Canonical SMILES | CC1CC(=O)C2=C1C=CC(=C2)CC(C)C |