DMTr-LNA-G(iBu)-3'-CED-phosphoramidite
DMTr-LNA-G(iBu)-3'-CED-phosphoramidite is a phosphoramidite used in the biomedical industry for the synthesis of modified nucleic acids. It contains DMTr-protected LNA-G(iBu)-3'-CED, which enables efficient and stable incorporation of modified bases during DNA/RNA synthesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 206055-77-8 |
| Pricing | Inquire |
| Cas | 206055-77-8 |
| Molecular Weight | 867.94 |
| Molecular Formula | C45H54N7O9P |
| Canonical SMILES | CC(C)C(=O)NC1=NC2=C(C(=O)N1)N=CN2C3C4C(C(O3)(CO4)COC(C5=CC=CC=C5)(C6=CC=C(C=C6)OC)C7=CC=C(C=C7)OC)OP(N(C(C)C)C(C)C)OCCC#N |