Triethyl citrate
Triethyl citrate is used to plasticize polymers in formulated pharmaceutical coatings. It is also used as a direct food additive for flavoring, for solvency, and as a surface active agent.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP4249 |
| Pricing | Inquire |
| Cas | 77-93-0 |
| Molecular Weight | 276.28 |
| Molecular Formula | C12H20O7 |
| Canonical SMILES | CCOC(=O)CC(CC(=O)OCC)(C(=O)OCC)O |