NO2A-(t-Bu ester)
NO2A-(t-Bu ester) is a chelator crucial in the synthesis of radiopharmaceuticals aimed at imaging biological structures. Its application extends to oncological treatments, notably breast and lung cancers, where it aids in the selective targeting of malignant cells for diagnostic and therapeutic interventions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 174137-97-4 |
| Pricing | Inquire |
| Cas | 174137-97-4 |
| Molecular Weight | 357.49 |
| Molecular Formula | C18H35N3O4 |
| Canonical SMILES | CC(C)(C)OC(=O)CN1CCNCCN(CC1)CC(=O)OC(C)(C)C |