1,3-DIAMINO-2,4,5,6-TETRAFLUOROBENZENE
1,3-DIAMINO-2,4,5,6-TETRAFLUOROBENZENE is a critical compound in the biomedical industry. It is often utilized in the synthesis of various pharmaceutical agents, specifically those targeting cancers and infectious diseases due to its reactivity and fluorination properties.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1198-64-7 |
| Pricing | Inquire |
| Cas | 1198-64-7 |
| Molecular Weight | 180.1 |
| Molecular Formula | C6H4F4N2 |
| Canonical SMILES | C1(=C(C(=C(C(=C1F)F)N)F)F)N |