Ac-WLA-AMC
Ac-WLA-AMC is a fluorogenic substrate for the β5c subunit of the 20S proteasome. Ac-WLA-AMC is cleaved to release the fluorescent moiety 7-amino-4-methylcoumarin (AMC), which can be used to quantify the β5c subunit activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1104011-59-7 |
| Pricing | Inquire |
| Cas | 1104011-59-7 |
| Molecular Weight | 587.7 |
| Molecular Formula | C32H37N5O6 |
| Canonical SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)C(C)NC(=O)C(CC(C)C)NC(=O)C(CC3=CNC4=CC=CC=C43)NC(=O)C |