7(8)-Dehydro Schisandrol A
7(8)-Dehydro Schisandrol A is an immensely powerful natural compound extensively employed in the research of a wide array of afflictions and maladies comprising hepatic impairments, malignancies, neurodegenerative disorders and cardiovascular irregularities.
| Supplier | BOC Sciences |
|---|---|
| Product # | 75684-45-6 |
| Pricing | Inquire |
| Cas | 75684-45-6 |
| Molecular Weight | 414.49 |
| Molecular Formula | C24H30O6 |
| Canonical SMILES | CC1CC2=CC(=C(C(=C2C3=C(C(=C(C=C3C=C1C)OC)OC)OC)OC)OC)OC |