Phosphoramidochloridic acid, N,N-dimethyl-, [(2S,6R)-6-(3,4-dihydro-5-methyl-2,4-dioxo-1(2H)-pyrimidinyl)-4-(triphenylmethyl)-2-morpholinyl]methyl ester
Phosphoramidochloridic acid, N,N-dimethyl-, [(2S,6R)-6-(3,4-dihydro-5-methyl-2,4-dioxo-1(2H)-pyrimidinyl)-4-(triphenylmethyl)-2-morpholinyl]methyl ester, represents an advancement in the biomedical sector. Employing cutting-edge science, this innovative compound showcases remarkable aptitude in the treatment of diverse ailments. By harnessing its potent therapeutic potential, it enables precise drug delivery to targeted areas and enables the implementation of gene therapy. Its exceptional molecular structure amplifies drug efficacy, empowering healthcare professionals to administer focused treatment for a wide array of medical conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 956139-30-3 |
| Pricing | Inquire |
| Cas | 956139-30-3 |
| Molecular Weight | 609.05 |
| Molecular Formula | C31H34ClN4O5P |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CN(CC(O2)COP(=O)(N(C)C)Cl)C(C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5 |