2-Methoxy-[13C,d3]-estrone
2-Methoxy-[13C,d3]-estrone is intended for use as an internal standard for 2-Methoxy Estrone. 2-Methoxy Estrone is an endogenous estrogen metabolite. 2-Methoxyestrone detection can be used as a breast cancer biomarker and help assess the risk-factors for development of breast cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-005698 |
| Pricing | Inquire |
| Cas | 1217460-84-8 |
| Molecular Weight | 304.40 |
| Molecular Formula | [13C]C18H21D3O3 |
| Canonical SMILES | CC12CCC3C(C1CCC2=O)CCC4=CC(=C(C=C34)OC)O |